C21H40O5Si — CID 101205734
(1R,4S,7S,8S,9S,12R)-12-[tert-butyl(dimethyl)silyl]oxy-8-(hydroxymethyl)-2,2,4-trimethyl-3-oxatricyclo[6.2.2.04,9]dodecane-7,9-diol (PubChem CID 101205734) has the molecular formula C21H40O5Si and a molecular weight of 400.63 g/mol. Its IUPAC name is (1R,4S,7S,8S,9S,12R)-12-[tert-butyl(dimethyl)silyl]oxy-8-(hydroxymethyl)-2,2,4-trimethyl-3-oxatricyclo[6.2.2.04,9]dodecane-7,9-diol.
| Compound Name | (1R,4S,7S,8S,9S,12R)-12-[tert-butyl(dimethyl)silyl]oxy-8-(hydroxymethyl)-2,2,4-trimethyl-3-oxatricyclo[6.2.2.04,9]dodecane-7,9-diol |
|---|---|
| PubChem CID | 101205734 |
| Molecular Formula | C21H40O5Si |
| Molecular Weight | 400.63 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | (1R,4S,7S,8S,9S,12R)-12-[tert-butyl(dimethyl)silyl]oxy-8-(hydroxymethyl)-2,2,4-trimethyl-3-oxatricyclo[6.2.2.04,9]dodecane-7,9-diol |
| SMILES | CC1(C)O[C@@]2(C)CC[C@H](O)[C@@]3(CO)[C@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1C[C@]32O |
| InChI | InChI=1S/C21H40O5Si/c1-17(2,3)27(7,8)25-16-11-14-12-21(24)19(6,26-18(14,4)5)10-9-15(23)20(16,21)13-22/h14-16,22-24H,9-13H2,1-8H3/t14-,15+,16-,19+,20+,21-/m1/s1 |
| InChIKey | CIYPKVZFENFSER-XQMBYAHQSA-N |
| XLogP | 3.22 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.63 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|