C22H40I2OSi — CID 139040450
[(1R,3R,6R,7S,8S)-3,7-bis(3-iodopropyl)-8-tricyclo[4.3.1.03,7]decanyl]oxy-tert-butyl-dimethylsilane (PubChem CID 139040450) has the molecular formula C22H40I2OSi and a molecular weight of 602.46 g/mol. Its IUPAC name is [(1R,3R,6R,7S,8S)-3,7-bis(3-iodopropyl)-8-tricyclo[4.3.1.03,7]decanyl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1R,3R,6R,7S,8S)-3,7-bis(3-iodopropyl)-8-tricyclo[4.3.1.03,7]decanyl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 139040450 |
| Molecular Formula | C22H40I2OSi |
| Molecular Weight | 602.46 g/mol |
| Exact Mass | 602.09 |
| IUPAC Name | [(1R,3R,6R,7S,8S)-3,7-bis(3-iodopropyl)-8-tricyclo[4.3.1.03,7]decanyl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C[C@@H]2C[C@H]3CC[C@@](CCCI)(C2)[C@]31CCCI |
| InChI | InChI=1S/C22H40I2OSi/c1-20(2,3)26(4,5)25-19-15-17-14-18-8-11-21(16-17,9-6-12-23)22(18,19)10-7-13-24/h17-19H,6-16H2,1-5H3/t17-,18+,19-,21-,22+/m0/s1 |
| InChIKey | UJQKKTZWDCFTAB-HIHICTBBSA-N |
| XLogP | 8.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.46 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|