C29H60O3Si — CID 140956897
9-[3-[tert-butyl(dimethyl)silyl]oxy-1-(9-hydroxynonyl)cyclopentyl]nonan-1-ol (PubChem CID 140956897) has the molecular formula C29H60O3Si and a molecular weight of 484.88 g/mol. Its IUPAC name is 9-[3-[tert-butyl(dimethyl)silyl]oxy-1-(9-hydroxynonyl)cyclopentyl]nonan-1-ol.
| Compound Name | 9-[3-[tert-butyl(dimethyl)silyl]oxy-1-(9-hydroxynonyl)cyclopentyl]nonan-1-ol |
|---|---|
| PubChem CID | 140956897 |
| Molecular Formula | C29H60O3Si |
| Molecular Weight | 484.88 g/mol |
| Exact Mass | 484.43 |
| IUPAC Name | 9-[3-[tert-butyl(dimethyl)silyl]oxy-1-(9-hydroxynonyl)cyclopentyl]nonan-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCC(CCCCCCCCCO)(CCCCCCCCCO)C1 |
| InChI | InChI=1S/C29H60O3Si/c1-28(2,3)33(4,5)32-27-20-23-29(26-27,21-16-12-8-6-10-14-18-24-30)22-17-13-9-7-11-15-19-25-31/h27,30-31H,6-26H2,1-5H3 |
| InChIKey | ZYFGGPCYKYPPDE-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.88 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|