C20H40O2Si — CID 10427395
4-[6-[tert-butyl(dimethyl)silyl]oxycyclodecylidene]butan-1-ol (PubChem CID 10427395) has the molecular formula C20H40O2Si and a molecular weight of 340.62 g/mol. Its IUPAC name is 4-[6-[tert-butyl(dimethyl)silyl]oxycyclodecylidene]butan-1-ol.
| Compound Name | 4-[6-[tert-butyl(dimethyl)silyl]oxycyclodecylidene]butan-1-ol |
|---|---|
| PubChem CID | 10427395 |
| Molecular Formula | C20H40O2Si |
| Molecular Weight | 340.62 g/mol |
| Exact Mass | 340.28 |
| IUPAC Name | 4-[6-[tert-butyl(dimethyl)silyl]oxycyclodecylidene]butan-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCCCC(=CCCCO)CCCC1 |
| InChI | InChI=1S/C20H40O2Si/c1-20(2,3)23(4,5)22-19-15-8-6-12-18(13-7-9-16-19)14-10-11-17-21/h14,19,21H,6-13,15-17H2,1-5H3/b18-14- |
| InChIKey | HIDJEITZUDDKDN-JXAWBTAJSA-N |
| XLogP | 6.21 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.62 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|