C20H42O2Si — CID 135014074
(E,4S,8R)-6,8-dimethyl-9-tri(propan-2-yl)silyloxynon-6-en-4-ol (PubChem CID 135014074) has the molecular formula C20H42O2Si and a molecular weight of 342.64 g/mol. Its IUPAC name is (E,4S,8R)-6,8-dimethyl-9-tri(propan-2-yl)silyloxynon-6-en-4-ol.
| Compound Name | (E,4S,8R)-6,8-dimethyl-9-tri(propan-2-yl)silyloxynon-6-en-4-ol |
|---|---|
| PubChem CID | 135014074 |
| Molecular Formula | C20H42O2Si |
| Molecular Weight | 342.64 g/mol |
| Exact Mass | 342.30 |
| IUPAC Name | (E,4S,8R)-6,8-dimethyl-9-tri(propan-2-yl)silyloxynon-6-en-4-ol |
| SMILES | CCC[C@H](O)C/C(C)=C/[C@@H](C)CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C20H42O2Si/c1-10-11-20(21)13-18(8)12-19(9)14-22-23(15(2)3,16(4)5)17(6)7/h12,15-17,19-21H,10-11,13-14H2,1-9H3/b18-12+/t19-,20+/m1/s1 |
| InChIKey | BETGDEGFQJVBKA-FRKBIFFFSA-N |
| XLogP | 6.31 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.64 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|