C17H38O2Si2 — CID 11174922
(Z)-1-[tert-butyl(dimethyl)silyl]oxy-2-(trimethylsilylmethyl)hept-1-en-4-ol (PubChem CID 11174922) has the molecular formula C17H38O2Si2 and a molecular weight of 330.66 g/mol. Its IUPAC name is (Z)-1-[tert-butyl(dimethyl)silyl]oxy-2-(trimethylsilylmethyl)hept-1-en-4-ol.
| Compound Name | (Z)-1-[tert-butyl(dimethyl)silyl]oxy-2-(trimethylsilylmethyl)hept-1-en-4-ol |
|---|---|
| PubChem CID | 11174922 |
| Molecular Formula | C17H38O2Si2 |
| Molecular Weight | 330.66 g/mol |
| Exact Mass | 330.24 |
| IUPAC Name | (Z)-1-[tert-butyl(dimethyl)silyl]oxy-2-(trimethylsilylmethyl)hept-1-en-4-ol |
| SMILES | CCCC(O)C/C(=C/O[Si](C)(C)C(C)(C)C)C[Si](C)(C)C |
| InChI | InChI=1S/C17H38O2Si2/c1-10-11-16(18)12-15(14-20(5,6)7)13-19-21(8,9)17(2,3)4/h13,16,18H,10-12,14H2,1-9H3/b15-13- |
| InChIKey | QSMWOVDUTJLKLW-SQFISAMPSA-N |
| XLogP | 5.78 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.66 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|