C12H24OSi — CID 11401599
6-(trimethylsilylmethyl)octa-6,7-dien-4-ol (PubChem CID 11401599) has the molecular formula C12H24OSi and a molecular weight of 212.41 g/mol. Its IUPAC name is 6-(trimethylsilylmethyl)octa-6,7-dien-4-ol.
| Compound Name | 6-(trimethylsilylmethyl)octa-6,7-dien-4-ol |
|---|---|
| PubChem CID | 11401599 |
| Molecular Formula | C12H24OSi |
| Molecular Weight | 212.41 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | 6-(trimethylsilylmethyl)octa-6,7-dien-4-ol |
| SMILES | C=C=C(CC(O)CCC)C[Si](C)(C)C |
| InChI | InChI=1S/C12H24OSi/c1-6-8-12(13)9-11(7-2)10-14(3,4)5/h12-13H,2,6,8-10H2,1,3-5H3 |
| InChIKey | HNITZUFBADYFJF-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|