C28H49IO4Si2 — CID 10651658
tert-butyl-[[(1S,2R,3R,6S,7R,8R)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(3-iodopropyl)-6-methyl-11,12-dioxatetracyclo[6.2.1.13,6.02,7]dodeca-4,9-dien-2-yl]methoxy]-dimethylsilane (PubChem CID 10651658) has the molecular formula C28H49IO4Si2 and a molecular weight of 632.77 g/mol. Its IUPAC name is tert-butyl-[[(1S,2R,3R,6S,7R,8R)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(3-iodopropyl)-6-methyl-11,12-dioxatetracyclo[6.2.1.13,6.02,7]dodeca-4,9-dien-2-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1S,2R,3R,6S,7R,8R)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(3-iodopropyl)-6-methyl-11,12-dioxatetracyclo[6.2.1.13,6.02,7]dodeca-4,9-dien-2-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10651658 |
| Molecular Formula | C28H49IO4Si2 |
| Molecular Weight | 632.77 g/mol |
| Exact Mass | 632.22 |
| IUPAC Name | tert-butyl-[[(1S,2R,3R,6S,7R,8R)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(3-iodopropyl)-6-methyl-11,12-dioxatetracyclo[6.2.1.13,6.02,7]dodeca-4,9-dien-2-yl]methoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@]12[C@H]3C=C[C@](C)(O3)[C@]1(CO[Si](C)(C)C(C)(C)C)[C@H]1C=C[C@]2(CCCI)O1 |
| InChI | InChI=1S/C28H49IO4Si2/c1-23(2,3)34(8,9)30-19-27-21-14-17-26(33-21,15-12-18-29)28(27,22-13-16-25(27,7)32-22)20-31-35(10,11)24(4,5)6/h13-14,16-17,21-22H,12,15,18-20H2,1-11H3/t21-,22-,25+,26+,27+,28+/m1/s1 |
| InChIKey | LQQPYDOIUQTWPV-KOGKQBTPSA-N |
| XLogP | 7.65 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.77 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|