C33H68O4Si3 — CID 101106170
[(1S,2R,4S,5R,6R,7S,9R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,6,10,10-tetramethyl-11-oxatricyclo[7.2.1.01,6]dodecan-7-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 101106170) has the molecular formula C33H68O4Si3 and a molecular weight of 613.16 g/mol. Its IUPAC name is [(1S,2R,4S,5R,6R,7S,9R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,6,10,10-tetramethyl-11-oxatricyclo[7.2.1.01,6]dodecan-7-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1S,2R,4S,5R,6R,7S,9R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,6,10,10-tetramethyl-11-oxatricyclo[7.2.1.01,6]dodecan-7-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 101106170 |
| Molecular Formula | C33H68O4Si3 |
| Molecular Weight | 613.16 g/mol |
| Exact Mass | 612.44 |
| IUPAC Name | [(1S,2R,4S,5R,6R,7S,9R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,6,10,10-tetramethyl-11-oxatricyclo[7.2.1.01,6]dodecan-7-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C[C@@H]1C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@]2(C)[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H]3C[C@]12OC3(C)C |
| InChI | InChI=1S/C33H68O4Si3/c1-23-20-25(34-38(14,15)28(2,3)4)27(36-40(18,19)30(8,9)10)32(13)26(35-39(16,17)29(5,6)7)21-24-22-33(23,32)37-31(24,11)12/h23-27H,20-22H2,1-19H3/t23-,24-,25+,26+,27+,32-,33+/m1/s1 |
| InChIKey | HHTGJAGEWRZTAD-KGRWXKDSSA-N |
| XLogP | 10.16 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.16 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|