C21H38O2Si — CID 99952559
tert-butyl-dimethyl-[[(1S,5R,7R,8S,10S,11S)-3,3,7,11-tetramethyl-12-oxatetracyclo[6.4.0.01,11.05,7]dodecan-10-yl]oxy]silane (PubChem CID 99952559) has the molecular formula C21H38O2Si and a molecular weight of 350.62 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(1S,5R,7R,8S,10S,11S)-3,3,7,11-tetramethyl-12-oxatetracyclo[6.4.0.01,11.05,7]dodecan-10-yl]oxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(1S,5R,7R,8S,10S,11S)-3,3,7,11-tetramethyl-12-oxatetracyclo[6.4.0.01,11.05,7]dodecan-10-yl]oxy]silane |
|---|---|
| PubChem CID | 99952559 |
| Molecular Formula | C21H38O2Si |
| Molecular Weight | 350.62 g/mol |
| Exact Mass | 350.26 |
| IUPAC Name | tert-butyl-dimethyl-[[(1S,5R,7R,8S,10S,11S)-3,3,7,11-tetramethyl-12-oxatetracyclo[6.4.0.01,11.05,7]dodecan-10-yl]oxy]silane |
| SMILES | CC1(C)C[C@@H]2C[C@@]2(C)[C@@H]2C[C@H](O[Si](C)(C)C(C)(C)C)[C@]3(C)O[C@@]23C1 |
| InChI | InChI=1S/C21H38O2Si/c1-17(2,3)24(8,9)22-16-10-15-19(6)12-14(19)11-18(4,5)13-21(15)20(16,7)23-21/h14-16H,10-13H2,1-9H3/t14-,15+,16+,19-,20+,21+/m1/s1 |
| InChIKey | DTVQVXOROXVZJM-TTYLFXKOSA-N |
| XLogP | 5.77 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.62 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|