C20H38O4Si — CID 10474337
[(1S,4S,4aS,8aS)-6,6-dimethoxy-8a-methylspiro[2,3,4a,5,7,8-hexahydro-1H-naphthalene-4,2'-oxirane]-1-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 10474337) has the molecular formula C20H38O4Si and a molecular weight of 370.61 g/mol. Its IUPAC name is [(1S,4S,4aS,8aS)-6,6-dimethoxy-8a-methylspiro[2,3,4a,5,7,8-hexahydro-1H-naphthalene-4,2'-oxirane]-1-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1S,4S,4aS,8aS)-6,6-dimethoxy-8a-methylspiro[2,3,4a,5,7,8-hexahydro-1H-naphthalene-4,2'-oxirane]-1-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10474337 |
| Molecular Formula | C20H38O4Si |
| Molecular Weight | 370.61 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | [(1S,4S,4aS,8aS)-6,6-dimethoxy-8a-methylspiro[2,3,4a,5,7,8-hexahydro-1H-naphthalene-4,2'-oxirane]-1-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | COC1(OC)CC[C@]2(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@@]3(CO3)[C@H]2C1 |
| InChI | InChI=1S/C20H38O4Si/c1-17(2,3)25(7,8)24-16-9-10-19(14-23-19)15-13-20(21-5,22-6)12-11-18(15,16)4/h15-16H,9-14H2,1-8H3/t15-,16-,18-,19+/m0/s1 |
| InChIKey | HGBGBGCIZHSBIG-PBWTXFEYSA-N |
| XLogP | 4.74 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.61 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|