C27H47ClO4Si — CID 10097461
(1R,2S,3R,8R,11S,12S,15S,16S)-15-[tert-butyl(dimethyl)silyl]oxy-2-chloro-6,6-dimethoxy-16-methylpentacyclo[9.7.0.01,3.03,8.012,16]octadecan-8-ol (PubChem CID 10097461) has the molecular formula C27H47ClO4Si and a molecular weight of 499.21 g/mol. Its IUPAC name is (1R,2S,3R,8R,11S,12S,15S,16S)-15-[tert-butyl(dimethyl)silyl]oxy-2-chloro-6,6-dimethoxy-16-methylpentacyclo[9.7.0.01,3.03,8.012,16]octadecan-8-ol.
| Compound Name | (1R,2S,3R,8R,11S,12S,15S,16S)-15-[tert-butyl(dimethyl)silyl]oxy-2-chloro-6,6-dimethoxy-16-methylpentacyclo[9.7.0.01,3.03,8.012,16]octadecan-8-ol |
|---|---|
| PubChem CID | 10097461 |
| Molecular Formula | C27H47ClO4Si |
| Molecular Weight | 499.21 g/mol |
| Exact Mass | 498.29 |
| IUPAC Name | (1R,2S,3R,8R,11S,12S,15S,16S)-15-[tert-butyl(dimethyl)silyl]oxy-2-chloro-6,6-dimethoxy-16-methylpentacyclo[9.7.0.01,3.03,8.012,16]octadecan-8-ol |
| SMILES | COC1(OC)CC[C@@]23[C@@H](Cl)[C@@]24CC[C@]2(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@H]2[C@@H]4CC[C@@]3(O)C1 |
| InChI | InChI=1S/C27H47ClO4Si/c1-22(2,3)33(7,8)32-20-10-9-18-19-11-12-24(29)17-25(30-5,31-6)14-16-27(24)21(28)26(19,27)15-13-23(18,20)4/h18-21,29H,9-17H2,1-8H3/t18-,19-,20-,21-,23-,24+,26-,27-/m0/s1 |
| InChIKey | SJEUUEGFGHSLIT-UPCKMPEASA-N |
| XLogP | 6.49 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.21 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|