C23H21BrO3 — CID 11743132
(3aS,5aS,7aR,7bS)-4-bromo-2,2-dimethyl-6,6-diphenyl-3a,5a,7a,7b-tetrahydrocyclobuta[g][1,3]benzodioxol-7-one (PubChem CID 11743132) has the molecular formula C23H21BrO3 and a molecular weight of 425.32 g/mol. Its IUPAC name is (3aS,5aS,7aR,7bS)-4-bromo-2,2-dimethyl-6,6-diphenyl-3a,5a,7a,7b-tetrahydrocyclobuta[g][1,3]benzodioxol-7-one.
| Compound Name | (3aS,5aS,7aR,7bS)-4-bromo-2,2-dimethyl-6,6-diphenyl-3a,5a,7a,7b-tetrahydrocyclobuta[g][1,3]benzodioxol-7-one |
|---|---|
| PubChem CID | 11743132 |
| Molecular Formula | C23H21BrO3 |
| Molecular Weight | 425.32 g/mol |
| Exact Mass | 424.07 |
| IUPAC Name | (3aS,5aS,7aR,7bS)-4-bromo-2,2-dimethyl-6,6-diphenyl-3a,5a,7a,7b-tetrahydrocyclobuta[g][1,3]benzodioxol-7-one |
| SMILES | CC1(C)O[C@H]2[C@@H]3C(=O)C(c4ccccc4)(c4ccccc4)[C@@H]3C=C(Br)[C@H]2O1 |
| InChI | InChI=1S/C23H21BrO3/c1-22(2)26-19-17(24)13-16-18(20(19)27-22)21(25)23(16,14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-13,16,18-20H,1-2H3/t16-,18-,19-,20+/m1/s1 |
| InChIKey | YBSZJSXUFXQCLR-AFYVEPGGSA-N |
| XLogP | 4.60 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.32 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |