C20H24O5 — CID 54464546
(5-methoxy-4,7,7-trimethyl-8-oxabicyclo[3.2.1]oct-3-en-2-yl) 3-(4-hydroxyphenyl)prop-2-enoate (PubChem CID 54464546) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is (5-methoxy-4,7,7-trimethyl-8-oxabicyclo[3.2.1]oct-3-en-2-yl) 3-(4-hydroxyphenyl)prop-2-enoate.
| Compound Name | (5-methoxy-4,7,7-trimethyl-8-oxabicyclo[3.2.1]oct-3-en-2-yl) 3-(4-hydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 54464546 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | (5-methoxy-4,7,7-trimethyl-8-oxabicyclo[3.2.1]oct-3-en-2-yl) 3-(4-hydroxyphenyl)prop-2-enoate |
| SMILES | COC12CC(C)(C)C(O1)C(OC(=O)C=Cc1ccc(O)cc1)C=C2C |
| InChI | InChI=1S/C20H24O5/c1-13-11-16(18-19(2,3)12-20(13,23-4)25-18)24-17(22)10-7-14-5-8-15(21)9-6-14/h5-11,16,18,21H,12H2,1-4H3 |
| InChIKey | XDXWESKRDNVGGK-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|