C25H24O10 — CID 53245839
methyl (1R,5R,7S)-3-benzoyloxy-7-(hydroxymethyl)-2-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy-6,8-dioxabicyclo[3.2.1]octane-5-carboxylate (PubChem CID 53245839) has the molecular formula C25H24O10 and a molecular weight of 484.46 g/mol. Its IUPAC name is methyl (1R,5R,7S)-3-benzoyloxy-7-(hydroxymethyl)-2-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy-6,8-dioxabicyclo[3.2.1]octane-5-carboxylate.
| Compound Name | methyl (1R,5R,7S)-3-benzoyloxy-7-(hydroxymethyl)-2-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy-6,8-dioxabicyclo[3.2.1]octane-5-carboxylate |
|---|---|
| PubChem CID | 53245839 |
| Molecular Formula | C25H24O10 |
| Molecular Weight | 484.46 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | methyl (1R,5R,7S)-3-benzoyloxy-7-(hydroxymethyl)-2-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy-6,8-dioxabicyclo[3.2.1]octane-5-carboxylate |
| SMILES | COC(=O)[C@@]12CC(OC(=O)c3ccccc3)C(OC(=O)/C=C/c3ccc(O)cc3)[C@H](O1)[C@H](CO)O2 |
| InChI | InChI=1S/C25H24O10/c1-31-24(30)25-13-18(32-23(29)16-5-3-2-4-6-16)21(22(35-25)19(14-26)34-25)33-20(28)12-9-15-7-10-17(27)11-8-15/h2-12,18-19,21-22,26-27H,13-14H2,1H3/b12-9+/t18?,19-,21?,22+,25+/m0/s1 |
| InChIKey | KVRYARMINIYCPX-KILSXIAYSA-N |
| XLogP | 1.59 |
| TPSA | 137.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.46 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|