C34H30O14 — CID 11411248
trans-(3R,5R)-3,5-bis[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]-1-hydroxy-4-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxycyclohexane-1-carboxylic acid (PubChem CID 11411248) has the molecular formula C34H30O14 and a molecular weight of 662.60 g/mol. Its IUPAC name is trans-(3R,5R)-3,5-bis[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]-1-hydroxy-4-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxycyclohexane-1-carboxylic acid.
| Compound Name | trans-(3R,5R)-3,5-bis[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]-1-hydroxy-4-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 11411248 |
| Molecular Formula | C34H30O14 |
| Molecular Weight | 662.60 g/mol |
| Exact Mass | 662.16 |
| IUPAC Name | trans-(3R,5R)-3,5-bis[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]-1-hydroxy-4-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxycyclohexane-1-carboxylic acid |
| SMILES | O=C(/C=C/c1ccc(O)cc1)OC1[C@H](OC(=O)/C=C/c2ccc(O)c(O)c2)CC(O)(C(=O)O)C[C@H]1OC(=O)/C=C/c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C34H30O14/c35-22-8-1-19(2-9-22)5-12-31(42)48-32-27(46-29(40)13-6-20-3-10-23(36)25(38)15-20)17-34(45,33(43)44)18-28(32)47-30(41)14-7-21-4-11-24(37)26(39)16-21/h1-16,27-28,32,35-39,45H,17-18H2,(H,43,44)/b12-5+,13-6+,14-7+/t27-,28-,32?,34?/m1/s1 |
| InChIKey | JUAREVOIBUFAFJ-NOBPIERGSA-N |
| XLogP | 3.00 |
| TPSA | 237.58 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.60 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|