C26H26O10 — CID 53247397
ethyl (1R,2R,3R,5R,7S)-3-benzoyloxy-7-(hydroxymethyl)-2-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy-6,8-dioxabicyclo[3.2.1]octane-5-carboxylate (PubChem CID 53247397) has the molecular formula C26H26O10 and a molecular weight of 498.48 g/mol. Its IUPAC name is ethyl (1R,2R,3R,5R,7S)-3-benzoyloxy-7-(hydroxymethyl)-2-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy-6,8-dioxabicyclo[3.2.1]octane-5-carboxylate.
| Compound Name | ethyl (1R,2R,3R,5R,7S)-3-benzoyloxy-7-(hydroxymethyl)-2-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy-6,8-dioxabicyclo[3.2.1]octane-5-carboxylate |
|---|---|
| PubChem CID | 53247397 |
| Molecular Formula | C26H26O10 |
| Molecular Weight | 498.48 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | ethyl (1R,2R,3R,5R,7S)-3-benzoyloxy-7-(hydroxymethyl)-2-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy-6,8-dioxabicyclo[3.2.1]octane-5-carboxylate |
| SMILES | CCOC(=O)[C@@]12C[C@@H](OC(=O)c3ccccc3)[C@@H](OC(=O)/C=C/c3ccc(O)cc3)[C@H](O1)[C@H](CO)O2 |
| InChI | InChI=1S/C26H26O10/c1-2-32-25(31)26-14-19(33-24(30)17-6-4-3-5-7-17)22(23(36-26)20(15-27)35-26)34-21(29)13-10-16-8-11-18(28)12-9-16/h3-13,19-20,22-23,27-28H,2,14-15H2,1H3/b13-10+/t19-,20+,22-,23-,26-/m1/s1 |
| InChIKey | XYYFGTRSCCJFAM-QPVUHVDESA-N |
| XLogP | 1.98 |
| TPSA | 137.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.48 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|