C16H16O5 — CID 166440217
[(2S)-4-methyl-5-oxo-2H-pyran-2-yl] (E)-3-(4-methoxyphenyl)prop-2-enoate (PubChem CID 166440217) has the molecular formula C16H16O5 and a molecular weight of 288.30 g/mol. Its IUPAC name is [(2S)-4-methyl-5-oxo-2H-pyran-2-yl] (E)-3-(4-methoxyphenyl)prop-2-enoate.
| Compound Name | [(2S)-4-methyl-5-oxo-2H-pyran-2-yl] (E)-3-(4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 166440217 |
| Molecular Formula | C16H16O5 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | [(2S)-4-methyl-5-oxo-2H-pyran-2-yl] (E)-3-(4-methoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(/C=C/C(=O)O[C@H]2C=C(C)C(=O)CO2)cc1 |
| InChI | InChI=1S/C16H16O5/c1-11-9-16(20-10-14(11)17)21-15(18)8-5-12-3-6-13(19-2)7-4-12/h3-9,16H,10H2,1-2H3/b8-5+/t16-/m0/s1 |
| InChIKey | KMMWSQKGWFWWBY-WHWKNOJMSA-N |
| XLogP | 2.12 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|