C16H30O5Si — CID 71681000
(2S,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(hydroxymethyl)-2-propan-2-yloxy-2H-pyran-5-one (PubChem CID 71681000) has the molecular formula C16H30O5Si and a molecular weight of 330.50 g/mol. Its IUPAC name is (2S,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(hydroxymethyl)-2-propan-2-yloxy-2H-pyran-5-one.
| Compound Name | (2S,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(hydroxymethyl)-2-propan-2-yloxy-2H-pyran-5-one |
|---|---|
| PubChem CID | 71681000 |
| Molecular Formula | C16H30O5Si |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | (2S,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(hydroxymethyl)-2-propan-2-yloxy-2H-pyran-5-one |
| SMILES | CC(C)O[C@@H]1C=C(CO)C(=O)[C@@H](CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C16H30O5Si/c1-11(2)20-14-8-12(9-17)15(18)13(21-14)10-19-22(6,7)16(3,4)5/h8,11,13-14,17H,9-10H2,1-7H3/t13-,14+/m1/s1 |
| InChIKey | HVRCPTYFJUITMW-KGLIPLIRSA-N |
| XLogP | 2.65 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|