C18H32O4Si — CID 122393359
(1R)-1-[(2S,3S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-propan-2-yloxy-3,6-dihydro-2H-pyran-3-yl]prop-2-yn-1-ol (PubChem CID 122393359) has the molecular formula C18H32O4Si and a molecular weight of 340.54 g/mol. Its IUPAC name is (1R)-1-[(2S,3S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-propan-2-yloxy-3,6-dihydro-2H-pyran-3-yl]prop-2-yn-1-ol.
| Compound Name | (1R)-1-[(2S,3S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-propan-2-yloxy-3,6-dihydro-2H-pyran-3-yl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 122393359 |
| Molecular Formula | C18H32O4Si |
| Molecular Weight | 340.54 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | (1R)-1-[(2S,3S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-propan-2-yloxy-3,6-dihydro-2H-pyran-3-yl]prop-2-yn-1-ol |
| SMILES | C#C[C@H](O)[C@@H]1C=C[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H]1OC(C)C |
| InChI | InChI=1S/C18H32O4Si/c1-9-16(19)15-11-10-14(22-17(15)21-13(2)3)12-20-23(7,8)18(4,5)6/h1,10-11,13-17,19H,12H2,2-8H3/t14-,15-,16-,17-/m0/s1 |
| InChIKey | HTHMVAJKAHBZAU-QAETUUGQSA-N |
| XLogP | 3.32 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.54 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|