C17H28N2O4Si — CID 102001161
(2S,3S,4R)-1-benzyl-2-[tert-butyl(dimethyl)silyl]oxy-4-nitropyrrolidin-3-ol (PubChem CID 102001161) has the molecular formula C17H28N2O4Si and a molecular weight of 352.51 g/mol. Its IUPAC name is (2S,3S,4R)-1-benzyl-2-[tert-butyl(dimethyl)silyl]oxy-4-nitropyrrolidin-3-ol.
| Compound Name | (2S,3S,4R)-1-benzyl-2-[tert-butyl(dimethyl)silyl]oxy-4-nitropyrrolidin-3-ol |
|---|---|
| PubChem CID | 102001161 |
| Molecular Formula | C17H28N2O4Si |
| Molecular Weight | 352.51 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | (2S,3S,4R)-1-benzyl-2-[tert-butyl(dimethyl)silyl]oxy-4-nitropyrrolidin-3-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H]([N+](=O)[O-])CN1Cc1ccccc1 |
| InChI | InChI=1S/C17H28N2O4Si/c1-17(2,3)24(4,5)23-16-15(20)14(19(21)22)12-18(16)11-13-9-7-6-8-10-13/h6-10,14-16,20H,11-12H2,1-5H3/t14-,15+,16+/m1/s1 |
| InChIKey | HBNGQXKSWMYDOV-PMPSAXMXSA-N |
| XLogP | 2.86 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.51 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|