C12H12N2O5 — CID 54292899
4-(furan-2-yl)-2,6-dimethyl-3-nitro-3,4-dihydropyridine-5-carboxylic acid (PubChem CID 54292899) has the molecular formula C12H12N2O5 and a molecular weight of 264.24 g/mol. Its IUPAC name is 4-(furan-2-yl)-2,6-dimethyl-3-nitro-3,4-dihydropyridine-5-carboxylic acid.
| Compound Name | 4-(furan-2-yl)-2,6-dimethyl-3-nitro-3,4-dihydropyridine-5-carboxylic acid |
|---|---|
| PubChem CID | 54292899 |
| Molecular Formula | C12H12N2O5 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 4-(furan-2-yl)-2,6-dimethyl-3-nitro-3,4-dihydropyridine-5-carboxylic acid |
| SMILES | CC1=NC(C)=C(C(=O)O)C(c2ccco2)C1[N+](=O)[O-] |
| InChI | InChI=1S/C12H12N2O5/c1-6-9(12(15)16)10(8-4-3-5-19-8)11(14(17)18)7(2)13-6/h3-5,10-11H,1-2H3,(H,15,16) |
| InChIKey | RYTDUOWZQJYZIS-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 105.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|