C19H14N2O3 — CID 7700112
(4S)-2-methyl-3-nitro-4-phenyl-3,4-dihydroindeno[1,2-b]pyridin-5-one (PubChem CID 7700112) has the molecular formula C19H14N2O3 and a molecular weight of 318.33 g/mol. Its IUPAC name is (4S)-2-methyl-3-nitro-4-phenyl-3,4-dihydroindeno[1,2-b]pyridin-5-one.
| Compound Name | (4S)-2-methyl-3-nitro-4-phenyl-3,4-dihydroindeno[1,2-b]pyridin-5-one |
|---|---|
| PubChem CID | 7700112 |
| Molecular Formula | C19H14N2O3 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | (4S)-2-methyl-3-nitro-4-phenyl-3,4-dihydroindeno[1,2-b]pyridin-5-one |
| SMILES | CC1=NC2=C(C(=O)c3ccccc32)[C@H](c2ccccc2)C1[N+](=O)[O-] |
| InChI | InChI=1S/C19H14N2O3/c1-11-18(21(23)24)15(12-7-3-2-4-8-12)16-17(20-11)13-9-5-6-10-14(13)19(16)22/h2-10,15,18H,1H3/t15-,18?/m0/s1 |
| InChIKey | YUQOQPPOBJNCEH-BUSXIPJBSA-N |
| XLogP | 3.50 |
| TPSA | 72.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|