C25H36O5Si — CID 11004776
methyl (5S)-5-[(1S,2R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-(furan-2-yl)-6-methylidene-1-bicyclo[3.2.1]octanyl]-5-hydroxypent-2-ynoate (PubChem CID 11004776) has the molecular formula C25H36O5Si and a molecular weight of 444.64 g/mol. Its IUPAC name is methyl (5S)-5-[(1S,2R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-(furan-2-yl)-6-methylidene-1-bicyclo[3.2.1]octanyl]-5-hydroxypent-2-ynoate.
| Compound Name | methyl (5S)-5-[(1S,2R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-(furan-2-yl)-6-methylidene-1-bicyclo[3.2.1]octanyl]-5-hydroxypent-2-ynoate |
|---|---|
| PubChem CID | 11004776 |
| Molecular Formula | C25H36O5Si |
| Molecular Weight | 444.64 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | methyl (5S)-5-[(1S,2R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-(furan-2-yl)-6-methylidene-1-bicyclo[3.2.1]octanyl]-5-hydroxypent-2-ynoate |
| SMILES | C=C1C[C@]2([C@@H](O)CC#CC(=O)OC)C[C@@]1(O[Si](C)(C)C(C)(C)C)CC[C@H]2c1ccco1 |
| InChI | InChI=1S/C25H36O5Si/c1-18-16-24(21(26)11-8-12-22(27)28-5)17-25(18,30-31(6,7)23(2,3)4)14-13-19(24)20-10-9-15-29-20/h9-10,15,19,21,26H,1,11,13-14,16-17H2,2-7H3/t19-,21-,24-,25-/m0/s1 |
| InChIKey | NBQNDPWPBZCAOW-VBCPDFOISA-N |
| XLogP | 5.18 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.64 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|