C17H35NO3SSi — CID 21362531
tert-butyl N-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]thian-3-yl]carbamate (PubChem CID 21362531) has the molecular formula C17H35NO3SSi and a molecular weight of 361.62 g/mol. Its IUPAC name is tert-butyl N-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]thian-3-yl]carbamate.
| Compound Name | tert-butyl N-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]thian-3-yl]carbamate |
|---|---|
| PubChem CID | 21362531 |
| Molecular Formula | C17H35NO3SSi |
| Molecular Weight | 361.62 g/mol |
| Exact Mass | 361.21 |
| IUPAC Name | tert-butyl N-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]thian-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CSCCC1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H35NO3SSi/c1-16(2,3)21-15(19)18-14-12-22-10-9-13(14)11-20-23(7,8)17(4,5)6/h13-14H,9-12H2,1-8H3,(H,18,19) |
| InChIKey | GZONQFLVWXCBKO-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.62 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|