C11H19NO3S — CID 59095027
tert-butyl N-[(3R,4R)-3-formylthian-4-yl]carbamate (PubChem CID 59095027) has the molecular formula C11H19NO3S and a molecular weight of 245.34 g/mol. Its IUPAC name is tert-butyl N-[(3R,4R)-3-formylthian-4-yl]carbamate.
| Compound Name | tert-butyl N-[(3R,4R)-3-formylthian-4-yl]carbamate |
|---|---|
| PubChem CID | 59095027 |
| Molecular Formula | C11H19NO3S |
| Molecular Weight | 245.34 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | tert-butyl N-[(3R,4R)-3-formylthian-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCSC[C@H]1C=O |
| InChI | InChI=1S/C11H19NO3S/c1-11(2,3)15-10(14)12-9-4-5-16-7-8(9)6-13/h6,8-9H,4-5,7H2,1-3H3,(H,12,14)/t8-,9-/m1/s1 |
| InChIKey | ZBYHZSQVJGDZGM-RKDXNWHRSA-N |
| XLogP | 1.83 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.34 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|