C13H23NO3 — CID 87517913
tert-butyl N-[(1S,2R)-2-formylcycloheptyl]carbamate (PubChem CID 87517913) has the molecular formula C13H23NO3 and a molecular weight of 241.33 g/mol. Its IUPAC name is tert-butyl N-[(1S,2R)-2-formylcycloheptyl]carbamate.
| Compound Name | tert-butyl N-[(1S,2R)-2-formylcycloheptyl]carbamate |
|---|---|
| PubChem CID | 87517913 |
| Molecular Formula | C13H23NO3 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | tert-butyl N-[(1S,2R)-2-formylcycloheptyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCCCC[C@H]1C=O |
| InChI | InChI=1S/C13H23NO3/c1-13(2,3)17-12(16)14-11-8-6-4-5-7-10(11)9-15/h9-11H,4-8H2,1-3H3,(H,14,16)/t10-,11-/m0/s1 |
| InChIKey | MJXWXYLRAYWJGA-QWRGUYRKSA-N |
| XLogP | 2.66 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|