C13H23NO4 — CID 170212604
tert-butyl N-[(1S,4R)-2-formyl-4-hydroxy-4-methylcyclohexyl]carbamate (PubChem CID 170212604) has the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. Its IUPAC name is tert-butyl N-[(1S,4R)-2-formyl-4-hydroxy-4-methylcyclohexyl]carbamate.
| Compound Name | tert-butyl N-[(1S,4R)-2-formyl-4-hydroxy-4-methylcyclohexyl]carbamate |
|---|---|
| PubChem CID | 170212604 |
| Molecular Formula | C13H23NO4 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | tert-butyl N-[(1S,4R)-2-formyl-4-hydroxy-4-methylcyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CC[C@@](C)(O)CC1C=O |
| InChI | InChI=1S/C13H23NO4/c1-12(2,3)18-11(16)14-10-5-6-13(4,17)7-9(10)8-15/h8-10,17H,5-7H2,1-4H3,(H,14,16)/t9?,10-,13+/m0/s1 |
| InChIKey | FTKXMOOLPCFMMZ-QQIFVLEESA-N |
| XLogP | 1.63 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|