C10H18N2O5S — CID 21362532
tert-butyl N-(4-formyl-1,1-dioxothiazinan-5-yl)carbamate (PubChem CID 21362532) has the molecular formula C10H18N2O5S and a molecular weight of 278.33 g/mol. Its IUPAC name is tert-butyl N-(4-formyl-1,1-dioxothiazinan-5-yl)carbamate.
| Compound Name | tert-butyl N-(4-formyl-1,1-dioxothiazinan-5-yl)carbamate |
|---|---|
| PubChem CID | 21362532 |
| Molecular Formula | C10H18N2O5S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | tert-butyl N-(4-formyl-1,1-dioxothiazinan-5-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CS(=O)(=O)NCC1C=O |
| InChI | InChI=1S/C10H18N2O5S/c1-10(2,3)17-9(14)12-8-6-18(15,16)11-4-7(8)5-13/h5,7-8,11H,4,6H2,1-3H3,(H,12,14) |
| InChIKey | BGFDSACHFLKSPM-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|