C6H13NO7S — CID 59248842
(5-amino-4,6-dihydroxyoxan-2-yl)methyl hydrogen sulfate (PubChem CID 59248842) has the molecular formula C6H13NO7S and a molecular weight of 243.24 g/mol. Its IUPAC name is (5-amino-4,6-dihydroxyoxan-2-yl)methyl hydrogen sulfate.
| Compound Name | (5-amino-4,6-dihydroxyoxan-2-yl)methyl hydrogen sulfate |
|---|---|
| PubChem CID | 59248842 |
| Molecular Formula | C6H13NO7S |
| Molecular Weight | 243.24 g/mol |
| Exact Mass | 243.04 |
| IUPAC Name | (5-amino-4,6-dihydroxyoxan-2-yl)methyl hydrogen sulfate |
| SMILES | NC1C(O)CC(COS(=O)(=O)O)OC1O |
| InChI | InChI=1S/C6H13NO7S/c7-5-4(8)1-3(14-6(5)9)2-13-15(10,11)12/h3-6,8-9H,1-2,7H2,(H,10,11,12) |
| InChIKey | LBTLTIAZMJJPJA-UHFFFAOYSA-N |
| XLogP | -2.40 |
| TPSA | 139.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.24 |
| LogP ≤ 5 | -2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|