C6H13NO10S2 — CID 89040433
[(4R)-3-amino-2-hydroxy-6-(sulfooxymethyl)oxan-4-yl] hydrogen sulfate (PubChem CID 89040433) has the molecular formula C6H13NO10S2 and a molecular weight of 323.30 g/mol. Its IUPAC name is [(4R)-3-amino-2-hydroxy-6-(sulfooxymethyl)oxan-4-yl] hydrogen sulfate.
| Compound Name | [(4R)-3-amino-2-hydroxy-6-(sulfooxymethyl)oxan-4-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 89040433 |
| Molecular Formula | C6H13NO10S2 |
| Molecular Weight | 323.30 g/mol |
| Exact Mass | 323.00 |
| IUPAC Name | [(4R)-3-amino-2-hydroxy-6-(sulfooxymethyl)oxan-4-yl] hydrogen sulfate |
| SMILES | NC1C(O)OC(COS(=O)(=O)O)C[C@H]1OS(=O)(=O)O |
| InChI | InChI=1S/C6H13NO10S2/c7-5-4(17-19(12,13)14)1-3(16-6(5)8)2-15-18(9,10)11/h3-6,8H,1-2,7H2,(H,9,10,11)(H,12,13,14)/t3?,4-,5?,6?/m1/s1 |
| InChIKey | KVTZZTUIROBZGP-FPPIULTPSA-N |
| XLogP | -2.57 |
| TPSA | 182.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.30 |
| LogP ≤ 5 | -2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|