C7H11O13S3-3 — CID 59920816
[(4S,6S)-6-methyl-4,5-disulfonatooxyoxan-2-yl]methyl sulfate (PubChem CID 59920816) has the molecular formula C7H11O13S3-3 and a molecular weight of 399.35 g/mol. Its IUPAC name is [(4S,6S)-6-methyl-4,5-disulfonatooxyoxan-2-yl]methyl sulfate.
| Compound Name | [(4S,6S)-6-methyl-4,5-disulfonatooxyoxan-2-yl]methyl sulfate |
|---|---|
| PubChem CID | 59920816 |
| Molecular Formula | C7H11O13S3-3 |
| Molecular Weight | 399.35 g/mol |
| Exact Mass | 398.94 |
| IUPAC Name | [(4S,6S)-6-methyl-4,5-disulfonatooxyoxan-2-yl]methyl sulfate |
| SMILES | C[C@@H]1OC(COS(=O)(=O)[O-])C[C@H](OS(=O)(=O)[O-])C1OS(=O)(=O)[O-] |
| InChI | InChI=1S/C7H14O13S3/c1-4-7(20-23(14,15)16)6(19-22(11,12)13)2-5(18-4)3-17-21(8,9)10/h4-7H,2-3H2,1H3,(H,8,9,10)(H,11,12,13)(H,14,15,16)/p-3/t4-,5?,6-,7?/m0/s1 |
| InChIKey | CKVISKIJJVEVCQ-DJOBPOQPSA-K |
| XLogP | -2.67 |
| TPSA | 208.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.35 |
| LogP ≤ 5 | -2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|