About carbanylium;[5-(ethoxymethyl)oxolan-2-yl]methyl sulfate
carbanylium;[5-(ethoxymethyl)oxolan-2-yl]methyl sulfate (PubChem CID 162136782) has the molecular formula C9H18O6S
and a molecular weight of 254.30 g/mol. Its IUPAC name is carbanylium;[5-(ethoxymethyl)oxolan-2-yl]methyl sulfate.
Molecular Properties
| Compound Name | carbanylium;[5-(ethoxymethyl)oxolan-2-yl]methyl sulfate |
| PubChem CID | 162136782 |
| Molecular Formula | C9H18O6S |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | carbanylium;[5-(ethoxymethyl)oxolan-2-yl]methyl sulfate |
| SMILES | CCOCC1CCC(COS(=O)(=O)[O-])O1.[CH3+] |
| InChI | InChI=1S/C8H16O6S.CH3/c1-2-12-5-7-3-4-8(14-7)6-13-15(9,10)11;/h7-8H,2-6H2,1H3,(H,9,10,11);1H3/q;+1/p-1 |
| InChIKey | ZJJYONWXMWRKMH-UHFFFAOYSA-M |
| XLogP | 0.50 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze carbanylium;[5-(ethoxymethyl)oxolan-2-yl]methyl sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanylium;[5-(ethoxymethyl)oxolan-2-yl]methyl sulfate?
The IUPAC name of carbanylium;[5-(ethoxymethyl)oxolan-2-yl]methyl sulfate (CID 162136782) is carbanylium;[5-(ethoxymethyl)oxolan-2-yl]methyl sulfate.
What is the SMILES notation for carbanylium;[5-(ethoxymethyl)oxolan-2-yl]methyl sulfate?
The canonical SMILES for carbanylium;[5-(ethoxymethyl)oxolan-2-yl]methyl sulfate is CCOCC1CCC(COS(=O)(=O)[O-])O1.[CH3+].
What is the InChIKey of carbanylium;[5-(ethoxymethyl)oxolan-2-yl]methyl sulfate?
The InChIKey is ZJJYONWXMWRKMH-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H16O6S.CH3/c1-2-12-5-7-3-4-8(14-7)6-13-15(9,10)11;/h7-8H,2-6H2,1H3,(H,9,10,11);1H3/q;+1/p-1.
What are the key properties of carbanylium;[5-(ethoxymethyl)oxolan-2-yl]methyl sulfate?
carbanylium;[5-(ethoxymethyl)oxolan-2-yl]methyl sulfate has a molecular weight of 254.30 g/mol, XLogP of 0.50, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for carbanylium;[5-(ethoxymethyl)oxolan-2-yl]methyl sulfate is sourced from PubChem (CID 162136782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).