C6H11O6S- — CID 59456784
[(2R)-4-hydroxyoxan-2-yl]methyl sulfate (PubChem CID 59456784) has the molecular formula C6H11O6S- and a molecular weight of 211.21 g/mol. Its IUPAC name is [(2R)-4-hydroxyoxan-2-yl]methyl sulfate.
| Compound Name | [(2R)-4-hydroxyoxan-2-yl]methyl sulfate |
|---|---|
| PubChem CID | 59456784 |
| Molecular Formula | C6H11O6S- |
| Molecular Weight | 211.21 g/mol |
| Exact Mass | 211.03 |
| IUPAC Name | [(2R)-4-hydroxyoxan-2-yl]methyl sulfate |
| SMILES | O=S(=O)([O-])OC[C@H]1CC(O)CCO1 |
| InChI | InChI=1S/C6H12O6S/c7-5-1-2-11-6(3-5)4-12-13(8,9)10/h5-7H,1-4H2,(H,8,9,10)/p-1/t5?,6-/m1/s1 |
| InChIKey | SLSFHHOTLLSTON-PRJDIBJQSA-M |
| XLogP | -1.00 |
| TPSA | 95.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.21 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|