About butane;2-ethyloxan-4-ol
butane;2-ethyloxan-4-ol (PubChem CID 156818442) has the molecular formula C11H24O2
and a molecular weight of 188.31 g/mol. Its IUPAC name is butane;2-ethyloxan-4-ol.
Molecular Properties
| Compound Name | butane;2-ethyloxan-4-ol |
| PubChem CID | 156818442 |
| Molecular Formula | C11H24O2 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.18 |
| IUPAC Name | butane;2-ethyloxan-4-ol |
| SMILES | CCC1CC(O)CCO1.CCCC |
| InChI | InChI=1S/C7H14O2.C4H10/c1-2-7-5-6(8)3-4-9-7;1-3-4-2/h6-8H,2-5H2,1H3;3-4H2,1-2H3 |
| InChIKey | WSECWRQJTQEXOO-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze butane;2-ethyloxan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;2-ethyloxan-4-ol?
The IUPAC name of butane;2-ethyloxan-4-ol (CID 156818442) is butane;2-ethyloxan-4-ol.
What is the SMILES notation for butane;2-ethyloxan-4-ol?
The canonical SMILES for butane;2-ethyloxan-4-ol is CCC1CC(O)CCO1.CCCC.
What is the InChIKey of butane;2-ethyloxan-4-ol?
The InChIKey is WSECWRQJTQEXOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O2.C4H10/c1-2-7-5-6(8)3-4-9-7;1-3-4-2/h6-8H,2-5H2,1H3;3-4H2,1-2H3.
What are the key properties of butane;2-ethyloxan-4-ol?
butane;2-ethyloxan-4-ol has a molecular weight of 188.31 g/mol, XLogP of 2.74, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butane;2-ethyloxan-4-ol is sourced from PubChem (CID 156818442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).