About (2R,4R)-2-ethyloxan-4-amine
(2R,4R)-2-ethyloxan-4-amine (PubChem CID 82651052) has the molecular formula C7H15NO
and a molecular weight of 129.20 g/mol. Its IUPAC name is (2R,4R)-2-ethyloxan-4-amine.
Molecular Properties
| Compound Name | (2R,4R)-2-ethyloxan-4-amine |
| PubChem CID | 82651052 |
| Molecular Formula | C7H15NO |
| Molecular Weight | 129.20 g/mol |
| Exact Mass | 129.12 |
| IUPAC Name | (2R,4R)-2-ethyloxan-4-amine |
| SMILES | CC[C@@H]1C[C@H](N)CCO1 |
| InChI | InChI=1S/C7H15NO/c1-2-7-5-6(8)3-4-9-7/h6-7H,2-5,8H2,1H3/t6-,7-/m1/s1 |
| InChIKey | UXZVPCXTWGZXHH-RNFRBKRXSA-N |
| XLogP | 0.90 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.20 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R,4R)-2-ethyloxan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,4R)-2-ethyloxan-4-amine?
The IUPAC name of (2R,4R)-2-ethyloxan-4-amine (CID 82651052) is (2R,4R)-2-ethyloxan-4-amine.
What is the SMILES notation for (2R,4R)-2-ethyloxan-4-amine?
The canonical SMILES for (2R,4R)-2-ethyloxan-4-amine is CC[C@@H]1C[C@H](N)CCO1.
What is the InChIKey of (2R,4R)-2-ethyloxan-4-amine?
The InChIKey is UXZVPCXTWGZXHH-RNFRBKRXSA-N. The full InChI is InChI=1S/C7H15NO/c1-2-7-5-6(8)3-4-9-7/h6-7H,2-5,8H2,1H3/t6-,7-/m1/s1.
What are the key properties of (2R,4R)-2-ethyloxan-4-amine?
(2R,4R)-2-ethyloxan-4-amine has a molecular weight of 129.20 g/mol, XLogP of 0.90, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,4R)-2-ethyloxan-4-amine is sourced from PubChem (CID 82651052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).