C6H14ClNO2 — CID 170902129
[(2R,4S)-4-aminooxan-2-yl]methanol;hydrochloride (PubChem CID 170902129) has the molecular formula C6H14ClNO2 and a molecular weight of 167.64 g/mol. Its IUPAC name is [(2R,4S)-4-aminooxan-2-yl]methanol;hydrochloride.
| Compound Name | [(2R,4S)-4-aminooxan-2-yl]methanol;hydrochloride |
|---|---|
| PubChem CID | 170902129 |
| Molecular Formula | C6H14ClNO2 |
| Molecular Weight | 167.64 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | [(2R,4S)-4-aminooxan-2-yl]methanol;hydrochloride |
| SMILES | Cl.N[C@H]1CCO[C@@H](CO)C1 |
| InChI | InChI=1S/C6H13NO2.ClH/c7-5-1-2-9-6(3-5)4-8;/h5-6,8H,1-4,7H2;1H/t5-,6+;/m0./s1 |
| InChIKey | DNCCNLRVKXMFOV-RIHPBJNCSA-N |
| XLogP | -0.09 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.64 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |