C6H11NO3 — CID 129103650
[(2R,4S)-4-nitrosooxan-2-yl]methanol (PubChem CID 129103650) has the molecular formula C6H11NO3 and a molecular weight of 145.16 g/mol. Its IUPAC name is [(2R,4S)-4-nitrosooxan-2-yl]methanol.
| Compound Name | [(2R,4S)-4-nitrosooxan-2-yl]methanol |
|---|---|
| PubChem CID | 129103650 |
| Molecular Formula | C6H11NO3 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | [(2R,4S)-4-nitrosooxan-2-yl]methanol |
| SMILES | O=N[C@H]1CCO[C@@H](CO)C1 |
| InChI | InChI=1S/C6H11NO3/c8-4-6-3-5(7-9)1-2-10-6/h5-6,8H,1-4H2/t5-,6+/m0/s1 |
| InChIKey | RJENBJMNVYBBNM-NTSWFWBYSA-N |
| XLogP | 0.29 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |