C7H12O10S2-2 — CID 59010995
[(4S)-4-methoxy-6-(sulfonatooxymethyl)oxan-3-yl] sulfate (PubChem CID 59010995) has the molecular formula C7H12O10S2-2 and a molecular weight of 320.30 g/mol. Its IUPAC name is [(4S)-4-methoxy-6-(sulfonatooxymethyl)oxan-3-yl] sulfate.
| Compound Name | [(4S)-4-methoxy-6-(sulfonatooxymethyl)oxan-3-yl] sulfate |
|---|---|
| PubChem CID | 59010995 |
| Molecular Formula | C7H12O10S2-2 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 319.99 |
| IUPAC Name | [(4S)-4-methoxy-6-(sulfonatooxymethyl)oxan-3-yl] sulfate |
| SMILES | CO[C@H]1CC(COS(=O)(=O)[O-])OCC1OS(=O)(=O)[O-] |
| InChI | InChI=1S/C7H14O10S2/c1-14-6-2-5(3-16-18(8,9)10)15-4-7(6)17-19(11,12)13/h5-7H,2-4H2,1H3,(H,8,9,10)(H,11,12,13)/p-2/t5?,6-,7?/m0/s1 |
| InChIKey | SDDLQKFNAPGWRT-HUDPQJTASA-L |
| XLogP | -1.89 |
| TPSA | 151.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|