C6H11NNa2O12S3 — CID 140659139
disodium;[5-(sulfoamino)-2-(sulfonatooxymethyl)oxan-4-yl] sulfate (PubChem CID 140659139) has the molecular formula C6H11NNa2O12S3 and a molecular weight of 431.33 g/mol. Its IUPAC name is disodium;[5-(sulfoamino)-2-(sulfonatooxymethyl)oxan-4-yl] sulfate.
| Compound Name | disodium;[5-(sulfoamino)-2-(sulfonatooxymethyl)oxan-4-yl] sulfate |
|---|---|
| PubChem CID | 140659139 |
| Molecular Formula | C6H11NNa2O12S3 |
| Molecular Weight | 431.33 g/mol |
| Exact Mass | 430.92 |
| IUPAC Name | disodium;[5-(sulfoamino)-2-(sulfonatooxymethyl)oxan-4-yl] sulfate |
| SMILES | O=S(=O)(O)NC1COC(COS(=O)(=O)[O-])CC1OS(=O)(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C6H13NO12S3.2Na/c8-20(9,10)7-5-3-17-4(2-18-21(11,12)13)1-6(5)19-22(14,15)16;;/h4-7H,1-3H2,(H,8,9,10)(H,11,12,13)(H,14,15,16);;/q;2*+1/p-2 |
| InChIKey | OEUYSQXDLYIXMQ-UHFFFAOYSA-L |
| XLogP | -9.13 |
| TPSA | 208.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.33 |
| LogP ≤ 5 | -9.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|