C6H11NNa2O10S2 — CID 140553784
disodium;[(3S,4S)-3,4-dihydroxy-5-(sulfonatoamino)oxan-2-yl]methyl sulfate (PubChem CID 140553784) has the molecular formula C6H11NNa2O10S2 and a molecular weight of 367.27 g/mol. Its IUPAC name is disodium;[(3S,4S)-3,4-dihydroxy-5-(sulfonatoamino)oxan-2-yl]methyl sulfate.
| Compound Name | disodium;[(3S,4S)-3,4-dihydroxy-5-(sulfonatoamino)oxan-2-yl]methyl sulfate |
|---|---|
| PubChem CID | 140553784 |
| Molecular Formula | C6H11NNa2O10S2 |
| Molecular Weight | 367.27 g/mol |
| Exact Mass | 366.96 |
| IUPAC Name | disodium;[(3S,4S)-3,4-dihydroxy-5-(sulfonatoamino)oxan-2-yl]methyl sulfate |
| SMILES | O=S(=O)([O-])NC1COC(COS(=O)(=O)[O-])[C@@H](O)[C@H]1O.[Na+].[Na+] |
| InChI | InChI=1S/C6H13NO10S2.2Na/c8-5-3(7-18(10,11)12)1-16-4(6(5)9)2-17-19(13,14)15;;/h3-9H,1-2H2,(H,10,11,12)(H,13,14,15);;/q;2*+1/p-2/t3?,4?,5-,6+;;/m0../s1 |
| InChIKey | YHMLBCZDDVHBDH-ZICKBONESA-L |
| XLogP | -9.99 |
| TPSA | 185.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.27 |
| LogP ≤ 5 | -9.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|