C13H16O10S2-2 — CID 123269458
[(4R)-4-phenylmethoxy-6-(sulfonatooxymethyl)oxan-3-yl] sulfate (PubChem CID 123269458) has the molecular formula C13H16O10S2-2 and a molecular weight of 396.40 g/mol. Its IUPAC name is [(4R)-4-phenylmethoxy-6-(sulfonatooxymethyl)oxan-3-yl] sulfate.
| Compound Name | [(4R)-4-phenylmethoxy-6-(sulfonatooxymethyl)oxan-3-yl] sulfate |
|---|---|
| PubChem CID | 123269458 |
| Molecular Formula | C13H16O10S2-2 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.02 |
| IUPAC Name | [(4R)-4-phenylmethoxy-6-(sulfonatooxymethyl)oxan-3-yl] sulfate |
| SMILES | O=S(=O)([O-])OCC1C[C@@H](OCc2ccccc2)C(OS(=O)(=O)[O-])CO1 |
| InChI | InChI=1S/C13H18O10S2/c14-24(15,16)22-8-11-6-12(13(9-20-11)23-25(17,18)19)21-7-10-4-2-1-3-5-10/h1-5,11-13H,6-9H2,(H,14,15,16)(H,17,18,19)/p-2/t11?,12-,13?/m1/s1 |
| InChIKey | FXBDNOARPHDIJN-OTTFEQOBSA-L |
| XLogP | -0.32 |
| TPSA | 151.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|