C6H13NO8S2 — CID 58720535
4-hydroxy-5-(sulfinoamino)-2-(sulfooxymethyl)oxane (PubChem CID 58720535) has the molecular formula C6H13NO8S2 and a molecular weight of 291.30 g/mol. Its IUPAC name is 4-hydroxy-5-(sulfinoamino)-2-(sulfooxymethyl)oxane.
| Compound Name | 4-hydroxy-5-(sulfinoamino)-2-(sulfooxymethyl)oxane |
|---|---|
| PubChem CID | 58720535 |
| Molecular Formula | C6H13NO8S2 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.01 |
| IUPAC Name | 4-hydroxy-5-(sulfinoamino)-2-(sulfooxymethyl)oxane |
| SMILES | O=S(O)NC1COC(COS(=O)(=O)O)CC1O |
| InChI | InChI=1S/C6H13NO8S2/c8-6-1-4(2-15-17(11,12)13)14-3-5(6)7-16(9)10/h4-8H,1-3H2,(H,9,10)(H,11,12,13) |
| InChIKey | JWSMZLDEPCIVCB-UHFFFAOYSA-N |
| XLogP | -1.95 |
| TPSA | 142.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|