C12H20O12S — CID 58899226
4,5-dihydroxy-3-[4-hydroxy-6-(sulfooxymethyl)oxan-2-yl]oxyoxane-2-carboxylic acid (PubChem CID 58899226) has the molecular formula C12H20O12S and a molecular weight of 388.35 g/mol. Its IUPAC name is 4,5-dihydroxy-3-[4-hydroxy-6-(sulfooxymethyl)oxan-2-yl]oxyoxane-2-carboxylic acid.
| Compound Name | 4,5-dihydroxy-3-[4-hydroxy-6-(sulfooxymethyl)oxan-2-yl]oxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 58899226 |
| Molecular Formula | C12H20O12S |
| Molecular Weight | 388.35 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | 4,5-dihydroxy-3-[4-hydroxy-6-(sulfooxymethyl)oxan-2-yl]oxyoxane-2-carboxylic acid |
| SMILES | O=C(O)C1OCC(O)C(O)C1OC1CC(O)CC(COS(=O)(=O)O)O1 |
| InChI | InChI=1S/C12H20O12S/c13-5-1-6(3-22-25(18,19)20)23-8(2-5)24-10-9(15)7(14)4-21-11(10)12(16)17/h5-11,13-15H,1-4H2,(H,16,17)(H,18,19,20) |
| InChIKey | OAUCGOYNAYIKSK-UHFFFAOYSA-N |
| XLogP | -2.74 |
| TPSA | 189.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.35 |
| LogP ≤ 5 | -2.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|