C13H23NO19S3 — CID 89292352
(3R,4R)-4-hydroxy-3-[(2S,4S,5S)-4-hydroxy-5-methoxy-3-(sulfoamino)-6-(sulfooxymethyl)oxan-2-yl]oxy-5-sulfooxyoxane-2-carboxylic acid (PubChem CID 89292352) has the molecular formula C13H23NO19S3 and a molecular weight of 593.52 g/mol. Its IUPAC name is (3R,4R)-4-hydroxy-3-[(2S,4S,5S)-4-hydroxy-5-methoxy-3-(sulfoamino)-6-(sulfooxymethyl)oxan-2-yl]oxy-5-sulfooxyoxane-2-carboxylic acid.
| Compound Name | (3R,4R)-4-hydroxy-3-[(2S,4S,5S)-4-hydroxy-5-methoxy-3-(sulfoamino)-6-(sulfooxymethyl)oxan-2-yl]oxy-5-sulfooxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 89292352 |
| Molecular Formula | C13H23NO19S3 |
| Molecular Weight | 593.52 g/mol |
| Exact Mass | 593.00 |
| IUPAC Name | (3R,4R)-4-hydroxy-3-[(2S,4S,5S)-4-hydroxy-5-methoxy-3-(sulfoamino)-6-(sulfooxymethyl)oxan-2-yl]oxy-5-sulfooxyoxane-2-carboxylic acid |
| SMILES | CO[C@@H]1C(COS(=O)(=O)O)O[C@@H](O[C@H]2C(C(=O)O)OCC(OS(=O)(=O)O)[C@@H]2O)C(NS(=O)(=O)O)[C@@H]1O |
| InChI | InChI=1S/C13H23NO19S3/c1-28-9-5(3-30-35(22,23)24)31-13(6(8(9)16)14-34(19,20)21)32-10-7(15)4(33-36(25,26)27)2-29-11(10)12(17)18/h4-11,13-16H,2-3H2,1H3,(H,17,18)(H,19,20,21)(H,22,23,24)(H,25,26,27)/t4?,5?,6?,7-,8-,9+,10+,11?,13-/m0/s1 |
| InChIKey | UBXAKUGKPZQKRS-MKASRZQDSA-N |
| XLogP | -4.91 |
| TPSA | 308.28 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.52 |
| LogP ≤ 5 | -4.91 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|