C12H21NO17S2 — CID 91859964
(2R,3S,4R,5R)-3-[(2R,3R,4R,5S,6R)-4,5-dihydroxy-3-(sulfoamino)-6-(sulfooxymethyl)oxan-2-yl]oxy-4,5,6-trihydroxyoxane-2-carboxylic acid (PubChem CID 91859964) has the molecular formula C12H21NO17S2 and a molecular weight of 515.42 g/mol. Its IUPAC name is (2R,3S,4R,5R)-3-[(2R,3R,4R,5S,6R)-4,5-dihydroxy-3-(sulfoamino)-6-(sulfooxymethyl)oxan-2-yl]oxy-4,5,6-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (2R,3S,4R,5R)-3-[(2R,3R,4R,5S,6R)-4,5-dihydroxy-3-(sulfoamino)-6-(sulfooxymethyl)oxan-2-yl]oxy-4,5,6-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 91859964 |
| Molecular Formula | C12H21NO17S2 |
| Molecular Weight | 515.42 g/mol |
| Exact Mass | 515.03 |
| IUPAC Name | (2R,3S,4R,5R)-3-[(2R,3R,4R,5S,6R)-4,5-dihydroxy-3-(sulfoamino)-6-(sulfooxymethyl)oxan-2-yl]oxy-4,5,6-trihydroxyoxane-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](COS(=O)(=O)O)[C@@H](O)[C@H](O)[C@H]1NS(=O)(=O)O |
| InChI | InChI=1S/C12H21NO17S2/c14-4-2(1-27-32(24,25)26)28-12(3(5(4)15)13-31(21,22)23)30-8-6(16)7(17)11(20)29-9(8)10(18)19/h2-9,11-17,20H,1H2,(H,18,19)(H,21,22,23)(H,24,25,26)/t2-,3-,4-,5-,6-,7-,8+,9-,11?,12-/m1/s1 |
| InChIKey | JMVQVXRMLCEYJF-FTZLHVDOSA-N |
| XLogP | -6.08 |
| TPSA | 296.14 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.42 |
| LogP ≤ 5 | -6.08 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|