C15H27NO20S3 — CID 11115266
(2R,3S,4S,5R,6R)-3-[(2R,3R,4R,5S,6R)-4,5-dihydroxy-3-(sulfoamino)-6-(sulfooxymethyl)oxan-2-yl]oxy-4-hydroxy-6-propan-2-yloxy-5-sulfooxyoxane-2-carboxylic acid (PubChem CID 11115266) has the molecular formula C15H27NO20S3 and a molecular weight of 637.57 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-3-[(2R,3R,4R,5S,6R)-4,5-dihydroxy-3-(sulfoamino)-6-(sulfooxymethyl)oxan-2-yl]oxy-4-hydroxy-6-propan-2-yloxy-5-sulfooxyoxane-2-carboxylic acid.
| Compound Name | (2R,3S,4S,5R,6R)-3-[(2R,3R,4R,5S,6R)-4,5-dihydroxy-3-(sulfoamino)-6-(sulfooxymethyl)oxan-2-yl]oxy-4-hydroxy-6-propan-2-yloxy-5-sulfooxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 11115266 |
| Molecular Formula | C15H27NO20S3 |
| Molecular Weight | 637.57 g/mol |
| Exact Mass | 637.03 |
| IUPAC Name | (2R,3S,4S,5R,6R)-3-[(2R,3R,4R,5S,6R)-4,5-dihydroxy-3-(sulfoamino)-6-(sulfooxymethyl)oxan-2-yl]oxy-4-hydroxy-6-propan-2-yloxy-5-sulfooxyoxane-2-carboxylic acid |
| SMILES | CC(C)O[C@@H]1O[C@@H](C(=O)O)[C@@H](O[C@H]2O[C@H](COS(=O)(=O)O)[C@@H](O)[C@H](O)[C@H]2NS(=O)(=O)O)[C@H](O)[C@H]1OS(=O)(=O)O |
| InChI | InChI=1S/C15H27NO20S3/c1-4(2)32-15-11(36-39(28,29)30)9(19)10(12(35-15)13(20)21)34-14-6(16-37(22,23)24)8(18)7(17)5(33-14)3-31-38(25,26)27/h4-12,14-19H,3H2,1-2H3,(H,20,21)(H,22,23,24)(H,25,26,27)(H,28,29,30)/t5-,6-,7-,8-,9+,10+,11-,12-,14-,15-/m1/s1 |
| InChIKey | XTDJVVQJJQMDSE-XZDSOUKRSA-N |
| XLogP | -4.82 |
| TPSA | 328.51 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.57 |
| LogP ≤ 5 | -4.82 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|