C15H21NO20S3 — CID 90741927
(3R,4R)-3-[(2S,4S)-4-(3-hydroperoxy-3-oxoprop-1-ynyl)-3-(sulfoamino)-6-(sulfooxymethyl)oxan-2-yl]oxy-4-hydroxy-5-sulfooxyoxane-2-carboxylic acid (PubChem CID 90741927) has the molecular formula C15H21NO20S3 and a molecular weight of 631.52 g/mol. Its IUPAC name is (3R,4R)-3-[(2S,4S)-4-(3-hydroperoxy-3-oxoprop-1-ynyl)-3-(sulfoamino)-6-(sulfooxymethyl)oxan-2-yl]oxy-4-hydroxy-5-sulfooxyoxane-2-carboxylic acid.
| Compound Name | (3R,4R)-3-[(2S,4S)-4-(3-hydroperoxy-3-oxoprop-1-ynyl)-3-(sulfoamino)-6-(sulfooxymethyl)oxan-2-yl]oxy-4-hydroxy-5-sulfooxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 90741927 |
| Molecular Formula | C15H21NO20S3 |
| Molecular Weight | 631.52 g/mol |
| Exact Mass | 630.98 |
| IUPAC Name | (3R,4R)-3-[(2S,4S)-4-(3-hydroperoxy-3-oxoprop-1-ynyl)-3-(sulfoamino)-6-(sulfooxymethyl)oxan-2-yl]oxy-4-hydroxy-5-sulfooxyoxane-2-carboxylic acid |
| SMILES | O=C(C#C[C@@H]1CC(COS(=O)(=O)O)O[C@@H](O[C@H]2C(C(=O)O)OCC(OS(=O)(=O)O)[C@@H]2O)C1NS(=O)(=O)O)OO |
| InChI | InChI=1S/C15H21NO20S3/c17-9(35-21)2-1-6-3-7(4-32-38(25,26)27)33-15(10(6)16-37(22,23)24)34-12-11(18)8(36-39(28,29)30)5-31-13(12)14(19)20/h6-8,10-13,15-16,18,21H,3-5H2,(H,19,20)(H,22,23,24)(H,25,26,27)(H,28,29,30)/t6-,7?,8?,10?,11+,12-,13?,15+/m1/s1 |
| InChIKey | FTTASYKPTYYALY-MRSDHDBQSA-N |
| XLogP | -4.26 |
| TPSA | 325.35 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.52 |
| LogP ≤ 5 | -4.26 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|