C8H15NO8S — CID 88533117
[(4R)-5-acetamido-4,6-dihydroxyoxan-2-yl]methyl hydrogen sulfate (PubChem CID 88533117) has the molecular formula C8H15NO8S and a molecular weight of 285.27 g/mol. Its IUPAC name is [(4R)-5-acetamido-4,6-dihydroxyoxan-2-yl]methyl hydrogen sulfate.
| Compound Name | [(4R)-5-acetamido-4,6-dihydroxyoxan-2-yl]methyl hydrogen sulfate |
|---|---|
| PubChem CID | 88533117 |
| Molecular Formula | C8H15NO8S |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | [(4R)-5-acetamido-4,6-dihydroxyoxan-2-yl]methyl hydrogen sulfate |
| SMILES | CC(=O)NC1C(O)OC(COS(=O)(=O)O)C[C@H]1O |
| InChI | InChI=1S/C8H15NO8S/c1-4(10)9-7-6(11)2-5(17-8(7)12)3-16-18(13,14)15/h5-8,11-12H,2-3H2,1H3,(H,9,10)(H,13,14,15)/t5?,6-,7?,8?/m1/s1 |
| InChIKey | ATXNMODVUPOPKK-QQJWGCFSSA-N |
| XLogP | -2.22 |
| TPSA | 142.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|