C7H15NO10S2 — CID 89349354
[(2S)-4-hydroxy-2-methoxy-6-(sulfooxymethyl)oxan-3-yl]sulfamic acid (PubChem CID 89349354) has the molecular formula C7H15NO10S2 and a molecular weight of 337.33 g/mol. Its IUPAC name is [(2S)-4-hydroxy-2-methoxy-6-(sulfooxymethyl)oxan-3-yl]sulfamic acid.
| Compound Name | [(2S)-4-hydroxy-2-methoxy-6-(sulfooxymethyl)oxan-3-yl]sulfamic acid |
|---|---|
| PubChem CID | 89349354 |
| Molecular Formula | C7H15NO10S2 |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.01 |
| IUPAC Name | [(2S)-4-hydroxy-2-methoxy-6-(sulfooxymethyl)oxan-3-yl]sulfamic acid |
| SMILES | CO[C@H]1OC(COS(=O)(=O)O)CC(O)C1NS(=O)(=O)O |
| InChI | InChI=1S/C7H15NO10S2/c1-16-7-6(8-19(10,11)12)5(9)2-4(18-7)3-17-20(13,14)15/h4-9H,2-3H2,1H3,(H,10,11,12)(H,13,14,15)/t4?,5?,6?,7-/m0/s1 |
| InChIKey | RMWNHPBGTWHAFB-XSNFGBRTSA-N |
| XLogP | -2.31 |
| TPSA | 168.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | -2.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|